About carbon dioxide;ethyl acetate
carbon dioxide;ethyl acetate (PubChem CID 86667926) has the molecular formula C5H8O4
and a molecular weight of 132.12 g/mol. Its IUPAC name is carbon dioxide;ethyl acetate.
Molecular Properties
| Compound Name | carbon dioxide;ethyl acetate |
| PubChem CID | 86667926 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | carbon dioxide;ethyl acetate |
| SMILES | CCOC(C)=O.O=C=O |
| InChI | InChI=1S/C4H8O2.CO2/c1-3-6-4(2)5;2-1-3/h3H2,1-2H3; |
| InChIKey | CNNJVIXHUHRLCP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;ethyl acetate?
The IUPAC name of carbon dioxide;ethyl acetate (CID 86667926) is carbon dioxide;ethyl acetate.
What is the SMILES notation for carbon dioxide;ethyl acetate?
The canonical SMILES for carbon dioxide;ethyl acetate is CCOC(C)=O.O=C=O.
What is the InChIKey of carbon dioxide;ethyl acetate?
The InChIKey is CNNJVIXHUHRLCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.CO2/c1-3-6-4(2)5;2-1-3/h3H2,1-2H3;.
What are the key properties of carbon dioxide;ethyl acetate?
carbon dioxide;ethyl acetate has a molecular weight of 132.12 g/mol, XLogP of -0.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;ethyl acetate is sourced from PubChem (CID 86667926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).