C20H22N4O2 — CID 3111963
ethyl N-[2,2-bis(benzylamino)-1-cyanoethenyl]carbamate (PubChem CID 3111963) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl N-[2,2-bis(benzylamino)-1-cyanoethenyl]carbamate.
| Compound Name | ethyl N-[2,2-bis(benzylamino)-1-cyanoethenyl]carbamate |
|---|---|
| PubChem CID | 3111963 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | ethyl N-[2,2-bis(benzylamino)-1-cyanoethenyl]carbamate |
| SMILES | CCOC(=O)NC(C#N)=C(NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-26-20(25)24-18(13-21)19(22-14-16-9-5-3-6-10-16)23-15-17-11-7-4-8-12-17/h3-12,22-23H,2,14-15H2,1H3,(H,24,25) |
| InChIKey | OMRGVXMUTVZIMH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|