C18H23N5O3 — CID 134914995
ethyl 4-[(E)-1-amino-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 134914995) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 4-[(E)-1-amino-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-1-amino-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134914995 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | ethyl 4-[(E)-1-amino-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(N)=C(\C#N)C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H23N5O3/c1-2-26-18(25)23-10-8-22(9-11-23)16(20)15(12-19)17(24)21-13-14-6-4-3-5-7-14/h3-7H,2,8-11,13,20H2,1H3,(H,21,24)/b16-15+ |
| InChIKey | PBXMVOWERDCJMJ-FOCLMDBBSA-N |
| XLogP | 0.77 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|