C16H20FN3O4 — CID 108530680
ethyl 4-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]piperazine-1-carboxylate (PubChem CID 108530680) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is ethyl 4-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108530680 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | ethyl 4-[2-[(4-fluorophenyl)methylamino]-2-oxoacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H20FN3O4/c1-2-24-16(23)20-9-7-19(8-10-20)15(22)14(21)18-11-12-3-5-13(17)6-4-12/h3-6H,2,7-11H2,1H3,(H,18,21) |
| InChIKey | KDFGIWYEGPAGNI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|