C20H28FN3O4 — CID 110305627
ethyl 4-[2-[5-(4-fluorophenyl)pentanoylamino]acetyl]piperazine-1-carboxylate (PubChem CID 110305627) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is ethyl 4-[2-[5-(4-fluorophenyl)pentanoylamino]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[5-(4-fluorophenyl)pentanoylamino]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110305627 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl 4-[2-[5-(4-fluorophenyl)pentanoylamino]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CNC(=O)CCCCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H28FN3O4/c1-2-28-20(27)24-13-11-23(12-14-24)19(26)15-22-18(25)6-4-3-5-16-7-9-17(21)10-8-16/h7-10H,2-6,11-15H2,1H3,(H,22,25) |
| InChIKey | NOIKNMOTGSDSFU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|