C20H26FN3O4 — CID 108975803
ethyl 4-[[1-[(4-fluorophenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]piperidine-1-carboxylate (PubChem CID 108975803) has the molecular formula C20H26FN3O4 and a molecular weight of 391.44 g/mol. Its IUPAC name is ethyl 4-[[1-[(4-fluorophenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[(4-fluorophenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108975803 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl 4-[[1-[(4-fluorophenyl)methylcarbamoyl]cyclopropanecarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2(C(=O)NCc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H26FN3O4/c1-2-28-19(27)24-11-7-16(8-12-24)23-18(26)20(9-10-20)17(25)22-13-14-3-5-15(21)6-4-14/h3-6,16H,2,7-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | XZICTSPIMFTHKP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|