C18H26FN3O3 — CID 109000410
ethyl 4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]piperidine-1-carboxylate (PubChem CID 109000410) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109000410 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | ethyl 4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CNCCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H26FN3O3/c1-2-25-18(24)22-11-8-16(9-12-22)21-17(23)13-20-10-7-14-3-5-15(19)6-4-14/h3-6,16,20H,2,7-13H2,1H3,(H,21,23) |
| InChIKey | MIMBZQVBOVSIDV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|