C18H22FN5O3 — CID 42403773
ethyl 4-[[1-[(4-fluorophenyl)methyl]triazole-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 42403773) has the molecular formula C18H22FN5O3 and a molecular weight of 375.40 g/mol. Its IUPAC name is ethyl 4-[[1-[(4-fluorophenyl)methyl]triazole-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-[(4-fluorophenyl)methyl]triazole-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42403773 |
| Molecular Formula | C18H22FN5O3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl 4-[[1-[(4-fluorophenyl)methyl]triazole-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cn(Cc3ccc(F)cc3)nn2)CC1 |
| InChI | InChI=1S/C18H22FN5O3/c1-2-27-18(26)23-9-7-15(8-10-23)20-17(25)16-12-24(22-21-16)11-13-3-5-14(19)6-4-13/h3-6,12,15H,2,7-11H2,1H3,(H,20,25) |
| InChIKey | CLNDKZSQGJOOFG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |