C17H26N4O4 — CID 109184058
ethyl 4-[[5-(2-methoxyethylamino)pyridine-2-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109184058) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[[5-(2-methoxyethylamino)pyridine-2-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(2-methoxyethylamino)pyridine-2-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109184058 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | ethyl 4-[[5-(2-methoxyethylamino)pyridine-2-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccc(NCCOC)cn2)CC1 |
| InChI | InChI=1S/C17H26N4O4/c1-3-25-17(23)21-9-6-13(7-10-21)20-16(22)15-5-4-14(12-19-15)18-8-11-24-2/h4-5,12-13,18H,3,6-11H2,1-2H3,(H,20,22) |
| InChIKey | OJOIPNNBZDUDPX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|