C14H16FNO3 — CID 44541628
ethyl 1-[(4-fluorophenyl)methylcarbamoyl]cyclopropane-1-carboxylate (PubChem CID 44541628) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is ethyl 1-[(4-fluorophenyl)methylcarbamoyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[(4-fluorophenyl)methylcarbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 44541628 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl 1-[(4-fluorophenyl)methylcarbamoyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H16FNO3/c1-2-19-13(18)14(7-8-14)12(17)16-9-10-3-5-11(15)6-4-10/h3-6H,2,7-9H2,1H3,(H,16,17) |
| InChIKey | IZEKRAPZRSPJIO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|