C20H23FN4O3 — CID 109211400
ethyl 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-pyridinyl]piperazine-1-carboxylate (PubChem CID 109211400) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is ethyl 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-pyridinyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109211400 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl 4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-pyridinyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccnc(C(=O)NCc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C20H23FN4O3/c1-2-28-20(27)25-11-9-24(10-12-25)17-7-8-22-18(13-17)19(26)23-14-15-3-5-16(21)6-4-15/h3-8,13H,2,9-12,14H2,1H3,(H,23,26) |
| InChIKey | ZQDJXWHWHCVALQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |