C12H16FN3O2 — CID 114011876
ethyl 4-(2-fluoro-4-pyridinyl)piperazine-1-carboxylate (PubChem CID 114011876) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is ethyl 4-(2-fluoro-4-pyridinyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-fluoro-4-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 114011876 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | ethyl 4-(2-fluoro-4-pyridinyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccnc(F)c2)CC1 |
| InChI | InChI=1S/C12H16FN3O2/c1-2-18-12(17)16-7-5-15(6-8-16)10-3-4-14-11(13)9-10/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | RORGVBRRTHXJNU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|