C11H17N5O2 — CID 103633734
ethyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate (PubChem CID 103633734) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is ethyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 103633734 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | ethyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nccnc2N)CC1 |
| InChI | InChI=1S/C11H17N5O2/c1-2-18-11(17)16-7-5-15(6-8-16)10-9(12)13-3-4-14-10/h3-4H,2,5-8H2,1H3,(H2,12,13) |
| InChIKey | MBIWUMUFZHWNAP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |