C12H18N4O2 — CID 107876769
ethyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate (PubChem CID 107876769) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107876769 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | ethyl 4-(2-amino-3-pyridinyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cccnc2N)CC1 |
| InChI | InChI=1S/C12H18N4O2/c1-2-18-12(17)16-8-6-15(7-9-16)10-4-3-5-14-11(10)13/h3-5H,2,6-9H2,1H3,(H2,13,14) |
| InChIKey | CPRQVOIESUUNJG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |