C13H20N4O2 — CID 175116323
[1-(2-amino-3-pyridinyl)-4-ethylpiperidin-4-yl] carbamate (PubChem CID 175116323) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is [1-(2-amino-3-pyridinyl)-4-ethylpiperidin-4-yl] carbamate.
| Compound Name | [1-(2-amino-3-pyridinyl)-4-ethylpiperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175116323 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [1-(2-amino-3-pyridinyl)-4-ethylpiperidin-4-yl] carbamate |
| SMILES | CCC1(OC(N)=O)CCN(c2cccnc2N)CC1 |
| InChI | InChI=1S/C13H20N4O2/c1-2-13(19-12(15)18)5-8-17(9-6-13)10-4-3-7-16-11(10)14/h3-4,7H,2,5-6,8-9H2,1H3,(H2,14,16)(H2,15,18) |
| InChIKey | KRZGEBVRJOFJBW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |