C18H17FN4OS — CID 138039119
[4-(2-fluoro-4-pyridinyl)piperazin-1-yl]-(5-methyl-1,2-benzothiazol-3-yl)methanone (PubChem CID 138039119) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is [4-(2-fluoro-4-pyridinyl)piperazin-1-yl]-(5-methyl-1,2-benzothiazol-3-yl)methanone.
| Compound Name | [4-(2-fluoro-4-pyridinyl)piperazin-1-yl]-(5-methyl-1,2-benzothiazol-3-yl)methanone |
|---|---|
| PubChem CID | 138039119 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [4-(2-fluoro-4-pyridinyl)piperazin-1-yl]-(5-methyl-1,2-benzothiazol-3-yl)methanone |
| SMILES | Cc1ccc2snc(C(=O)N3CCN(c4ccnc(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C18H17FN4OS/c1-12-2-3-15-14(10-12)17(21-25-15)18(24)23-8-6-22(7-9-23)13-4-5-20-16(19)11-13/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | BPWGYJRQAPXMCK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|