C17H18N6O — CID 78858969
(5-methyl-1H-indazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 78858969) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is (5-methyl-1H-indazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (5-methyl-1H-indazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 78858969 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (5-methyl-1H-indazol-3-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc2[nH]nc(C(=O)N3CCN(c4ncccn4)CC3)c2c1 |
| InChI | InChI=1S/C17H18N6O/c1-12-3-4-14-13(11-12)15(21-20-14)16(24)22-7-9-23(10-8-22)17-18-5-2-6-19-17/h2-6,11H,7-10H2,1H3,(H,20,21) |
| InChIKey | AYGDNIKNOKKAGN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |