C12H15F3N4O2 — CID 155980463
ethyl 4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 155980463) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is ethyl 4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155980463 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | ethyl 4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C12H15F3N4O2/c1-2-21-11(20)19-7-5-18(6-8-19)10-16-4-3-9(17-10)12(13,14)15/h3-4H,2,5-8H2,1H3 |
| InChIKey | NUGXOTQYDBCGTR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |