C18H28N6O3 — CID 109302562
ethyl 4-[4-(4-ethylpiperazine-1-carbonyl)pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 109302562) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[4-(4-ethylpiperazine-1-carbonyl)pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(4-ethylpiperazine-1-carbonyl)pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109302562 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | ethyl 4-[4-(4-ethylpiperazine-1-carbonyl)pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nccc(C(=O)N3CCN(CC)CC3)n2)CC1 |
| InChI | InChI=1S/C18H28N6O3/c1-3-21-7-9-22(10-8-21)16(25)15-5-6-19-17(20-15)23-11-13-24(14-12-23)18(26)27-4-2/h5-6H,3-4,7-14H2,1-2H3 |
| InChIKey | PYRJIWDJIJNQBJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |