C22H30N6O — CID 109302552
[2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 109302552) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is [2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109302552 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [2-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2ccnc(N3CCN(Cc4ccccc4)CC3)n2)CC1 |
| InChI | InChI=1S/C22H30N6O/c1-2-25-10-14-27(15-11-25)21(29)20-8-9-23-22(24-20)28-16-12-26(13-17-28)18-19-6-4-3-5-7-19/h3-9H,2,10-18H2,1H3 |
| InChIKey | VVSCGNSCKJYJSD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |