C14H17F3N4O — CID 56826568
3-methyl-1-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]but-2-en-1-one (PubChem CID 56826568) has the molecular formula C14H17F3N4O and a molecular weight of 314.31 g/mol. Its IUPAC name is 3-methyl-1-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]but-2-en-1-one.
| Compound Name | 3-methyl-1-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 56826568 |
| Molecular Formula | C14H17F3N4O |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-methyl-1-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]but-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H17F3N4O/c1-10(2)9-12(22)20-5-7-21(8-6-20)13-18-4-3-11(19-13)14(15,16)17/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | ULKOSOPDTDDXNW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|