C11H13F3N4O2 — CID 67365390
[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]carbamic acid (PubChem CID 67365390) has the molecular formula C11H13F3N4O2 and a molecular weight of 290.24 g/mol. Its IUPAC name is [1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 67365390 |
| Molecular Formula | C11H13F3N4O2 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C11H13F3N4O2/c12-11(13,14)8-1-4-15-9(17-8)18-5-2-7(3-6-18)16-10(19)20/h1,4,7,16H,2-3,5-6H2,(H,19,20) |
| InChIKey | DISLDBXQNWWEBK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |