C12H14F3N3O2 — CID 67244637
[1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamic acid (PubChem CID 67244637) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is [1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 67244637 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)8-1-4-16-10(7-8)18-5-2-9(3-6-18)17-11(19)20/h1,4,7,9,17H,2-3,5-6H2,(H,19,20) |
| InChIKey | NXBNRBHBPLGJQS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |