C12H14F3N3O2 — CID 66329032
2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetic acid (PubChem CID 66329032) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 66329032 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)9-1-2-16-10(7-9)18-5-3-17(4-6-18)8-11(19)20/h1-2,7H,3-6,8H2,(H,19,20) |
| InChIKey | WXQDLXUXHSVXKG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |