C15H19F3N4O2 — CID 133358979
2-oxo-N-propan-2-yl-2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 133358979) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-oxo-N-propan-2-yl-2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | 2-oxo-N-propan-2-yl-2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 133358979 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-oxo-N-propan-2-yl-2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)NC(=O)C(=O)N1CCN(c2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C15H19F3N4O2/c1-10(2)20-13(23)14(24)22-7-5-21(6-8-22)12-9-11(3-4-19-12)15(16,17)18/h3-4,9-10H,5-8H2,1-2H3,(H,20,23) |
| InChIKey | XEFIODSFNULGMU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|