C13H17F3N4S — CID 66328060
2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanethioamide (PubChem CID 66328060) has the molecular formula C13H17F3N4S and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 66328060 |
| Molecular Formula | C13H17F3N4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanethioamide |
| SMILES | CC(C(N)=S)N1CCN(c2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C13H17F3N4S/c1-9(12(17)21)19-4-6-20(7-5-19)11-8-10(2-3-18-11)13(14,15)16/h2-3,8-9H,4-7H2,1H3,(H2,17,21) |
| InChIKey | XHAFGUBKQREQKK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|