C12H15F3N4 — CID 66329242
1-[4-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboximidamide (PubChem CID 66329242) has the molecular formula C12H15F3N4 and a molecular weight of 272.27 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboximidamide.
| Compound Name | 1-[4-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboximidamide |
|---|---|
| PubChem CID | 66329242 |
| Molecular Formula | C12H15F3N4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-[4-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCCN(c2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C12H15F3N4/c13-12(14,15)9-3-4-18-10(6-9)19-5-1-2-8(7-19)11(16)17/h3-4,6,8H,1-2,5,7H2,(H3,16,17) |
| InChIKey | JQNFDLBCSNCIMT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|