C13H18F3N3O2S — CID 97221826
N-[[(3S)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 97221826) has the molecular formula C13H18F3N3O2S and a molecular weight of 337.37 g/mol. Its IUPAC name is N-[[(3S)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 97221826 |
| Molecular Formula | C13H18F3N3O2S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[[(3S)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1CCCN(c2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C13H18F3N3O2S/c1-22(20,21)18-8-10-3-2-6-19(9-10)12-7-11(4-5-17-12)13(14,15)16/h4-5,7,10,18H,2-3,6,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | NYPISPWYUUMJDP-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |