C18H20F3N3O — CID 95724010
(3R)-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-amine (PubChem CID 95724010) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is (3R)-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-amine.
| Compound Name | (3R)-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-amine |
|---|---|
| PubChem CID | 95724010 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (3R)-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)-2-pyridinyl]piperidin-3-amine |
| SMILES | COc1ccc(N[C@@H]2CCCN(c3cc(C(F)(F)F)ccn3)C2)cc1 |
| InChI | InChI=1S/C18H20F3N3O/c1-25-16-6-4-14(5-7-16)23-15-3-2-10-24(12-15)17-11-13(8-9-22-17)18(19,20)21/h4-9,11,15,23H,2-3,10,12H2,1H3/t15-/m1/s1 |
| InChIKey | TYWLHFFOGKYVBO-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|