C16H18F3N5 — CID 154737129
N-[1-(6-methylpyridazin-3-yl)piperidin-3-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 154737129) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is N-[1-(6-methylpyridazin-3-yl)piperidin-3-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-(6-methylpyridazin-3-yl)piperidin-3-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 154737129 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[1-(6-methylpyridazin-3-yl)piperidin-3-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1ccc(N2CCCC(Nc3cc(C(F)(F)F)ccn3)C2)nn1 |
| InChI | InChI=1S/C16H18F3N5/c1-11-4-5-15(23-22-11)24-8-2-3-13(10-24)21-14-9-12(6-7-20-14)16(17,18)19/h4-7,9,13H,2-3,8,10H2,1H3,(H,20,21) |
| InChIKey | VNUCLDXRLUXMNO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |