C11H14F2N4 — CID 112675527
1-(3,5-difluoro-2-pyridinyl)piperidine-3-carboximidamide (PubChem CID 112675527) has the molecular formula C11H14F2N4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-pyridinyl)piperidine-3-carboximidamide.
| Compound Name | 1-(3,5-difluoro-2-pyridinyl)piperidine-3-carboximidamide |
|---|---|
| PubChem CID | 112675527 |
| Molecular Formula | C11H14F2N4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(3,5-difluoro-2-pyridinyl)piperidine-3-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCCN(c2ncc(F)cc2F)C1 |
| InChI | InChI=1S/C11H14F2N4/c12-8-4-9(13)11(16-5-8)17-3-1-2-7(6-17)10(14)15/h4-5,7H,1-3,6H2,(H3,14,15) |
| InChIKey | FQFVRLQNEZIRDK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|