C10H12ClFN4O — CID 79727211
4-(5-chloro-3-fluoro-2-pyridinyl)morpholine-2-carboximidamide (PubChem CID 79727211) has the molecular formula C10H12ClFN4O and a molecular weight of 258.68 g/mol. Its IUPAC name is 4-(5-chloro-3-fluoro-2-pyridinyl)morpholine-2-carboximidamide.
| Compound Name | 4-(5-chloro-3-fluoro-2-pyridinyl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79727211 |
| Molecular Formula | C10H12ClFN4O |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-(5-chloro-3-fluoro-2-pyridinyl)morpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(c2ncc(Cl)cc2F)CCO1 |
| InChI | InChI=1S/C10H12ClFN4O/c11-6-3-7(12)10(15-4-6)16-1-2-17-8(5-16)9(13)14/h3-4,8H,1-2,5H2,(H3,13,14) |
| InChIKey | OVQZSAXNSYNVGH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|