C11H13ClFN3O — CID 79727259
1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 79727259) has the molecular formula C11H13ClFN3O and a molecular weight of 257.70 g/mol. Its IUPAC name is 1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 79727259 |
| Molecular Formula | C11H13ClFN3O |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C11H13ClFN3O/c12-8-5-9(13)11(15-6-8)16-3-1-7(2-4-16)10(14)17/h5-7H,1-4H2,(H2,14,17) |
| InChIKey | OIGXIXLCPPSKAS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |