C16H21ClFN3O — CID 171335489
N-[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-4-yl]-N-methylcyclobutanecarboxamide (PubChem CID 171335489) has the molecular formula C16H21ClFN3O and a molecular weight of 325.81 g/mol. Its IUPAC name is N-[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-4-yl]-N-methylcyclobutanecarboxamide.
| Compound Name | N-[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-4-yl]-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 171335489 |
| Molecular Formula | C16H21ClFN3O |
| Molecular Weight | 325.81 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[1-(5-chloro-3-fluoro-2-pyridinyl)piperidin-4-yl]-N-methylcyclobutanecarboxamide |
| SMILES | CN(C(=O)C1CCC1)C1CCN(c2ncc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C16H21ClFN3O/c1-20(16(22)11-3-2-4-11)13-5-7-21(8-6-13)15-14(18)9-12(17)10-19-15/h9-11,13H,2-8H2,1H3 |
| InChIKey | MTNXMLCNNHVFRT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |