C13H18ClFN4O — CID 79727350
N-(2-aminoethyl)-1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 79727350) has the molecular formula C13H18ClFN4O and a molecular weight of 300.76 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 79727350 |
| Molecular Formula | C13H18ClFN4O |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(2-aminoethyl)-1-(5-chloro-3-fluoro-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(c2ncc(Cl)cc2F)C1 |
| InChI | InChI=1S/C13H18ClFN4O/c14-10-6-11(15)12(18-7-10)19-5-1-2-9(8-19)13(20)17-4-3-16/h6-7,9H,1-5,8,16H2,(H,17,20) |
| InChIKey | PRFUTDYPBSTCHQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |