C11H17N5O — CID 21082843
1-(3,5-diamino-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 21082843) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(3,5-diamino-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,5-diamino-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 21082843 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(3,5-diamino-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncc(N)cc2N)CC1 |
| InChI | InChI=1S/C11H17N5O/c12-8-5-9(13)11(15-6-8)16-3-1-7(2-4-16)10(14)17/h5-7H,1-4,12-13H2,(H2,14,17) |
| InChIKey | FABXCQMSJQEPRG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |