C9H14N4O — CID 21082858
2-morpholin-4-ylpyridine-3,5-diamine (PubChem CID 21082858) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-morpholin-4-ylpyridine-3,5-diamine.
| Compound Name | 2-morpholin-4-ylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 21082858 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-morpholin-4-ylpyridine-3,5-diamine |
| SMILES | Nc1cnc(N2CCOCC2)c(N)c1 |
| InChI | InChI=1S/C9H14N4O/c10-7-5-8(11)9(12-6-7)13-1-3-14-4-2-13/h5-6H,1-4,10-11H2 |
| InChIKey | ZDAJRYQFACBWFI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |