C10H12N4OS — CID 118224190
2-morpholin-4-yl-[1,3]thiazolo[4,5-b]pyridin-6-amine (PubChem CID 118224190) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-morpholin-4-yl-[1,3]thiazolo[4,5-b]pyridin-6-amine.
| Compound Name | 2-morpholin-4-yl-[1,3]thiazolo[4,5-b]pyridin-6-amine |
|---|---|
| PubChem CID | 118224190 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-morpholin-4-yl-[1,3]thiazolo[4,5-b]pyridin-6-amine |
| SMILES | Nc1cnc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C10H12N4OS/c11-7-5-8-9(12-6-7)13-10(16-8)14-1-3-15-4-2-14/h5-6H,1-4,11H2 |
| InChIKey | QNYGFRWZPLASGJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |