C11H16N4O3S — CID 15063236
2,6-dimorpholin-4-yl-1,3,5-thiadiazin-4-one (PubChem CID 15063236) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2,6-dimorpholin-4-yl-1,3,5-thiadiazin-4-one.
| Compound Name | 2,6-dimorpholin-4-yl-1,3,5-thiadiazin-4-one |
|---|---|
| PubChem CID | 15063236 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2,6-dimorpholin-4-yl-1,3,5-thiadiazin-4-one |
| SMILES | O=c1nc(N2CCOCC2)sc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H16N4O3S/c16-9-12-10(14-1-5-17-6-2-14)19-11(13-9)15-3-7-18-8-4-15/h1-8H2 |
| InChIKey | BYVCLWZVIAZVKE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |