C8H11N3O3S — CID 154487330
4-amino-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 154487330) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-amino-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-amino-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 154487330 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-amino-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid |
| SMILES | Nc1nc(N2CCOCC2)sc1C(=O)O |
| InChI | InChI=1S/C8H11N3O3S/c9-6-5(7(12)13)15-8(10-6)11-1-3-14-4-2-11/h1-4,9H2,(H,12,13) |
| InChIKey | FNCYXUJQZFDLTF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |