C13H18N4O2S — CID 114414556
(4-amino-2-morpholin-4-yl-1,3-thiazol-5-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114414556) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is (4-amino-2-morpholin-4-yl-1,3-thiazol-5-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (4-amino-2-morpholin-4-yl-1,3-thiazol-5-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114414556 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (4-amino-2-morpholin-4-yl-1,3-thiazol-5-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | Nc1nc(N2CCOCC2)sc1C(=O)N1CC=CCC1 |
| InChI | InChI=1S/C13H18N4O2S/c14-11-10(12(18)16-4-2-1-3-5-16)20-13(15-11)17-6-8-19-9-7-17/h1-2H,3-9,14H2 |
| InChIKey | WBIRRJYWNHCSAP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|