C8H14AlN3OS — CID 163448006
(5-alumanyl-2-morpholin-4-yl-1,3-thiazol-4-yl)methanamine (PubChem CID 163448006) has the molecular formula C8H14AlN3OS and a molecular weight of 227.27 g/mol. Its IUPAC name is (5-alumanyl-2-morpholin-4-yl-1,3-thiazol-4-yl)methanamine.
| Compound Name | (5-alumanyl-2-morpholin-4-yl-1,3-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 163448006 |
| Molecular Formula | C8H14AlN3OS |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (5-alumanyl-2-morpholin-4-yl-1,3-thiazol-4-yl)methanamine |
| SMILES | NCc1nc(N2CCOCC2)sc1[AlH2] |
| InChI | InChI=1S/C8H12N3OS.Al.2H/c9-5-7-6-13-8(10-7)11-1-3-12-4-2-11;;;/h1-5,9H2;;; |
| InChIKey | BEDSEBMEYUMGLG-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |