C11H18N4O3S — CID 19827638
4-(2-morpholin-4-yl-5-nitro-1,3-thiazol-4-yl)butan-1-amine (PubChem CID 19827638) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-(2-morpholin-4-yl-5-nitro-1,3-thiazol-4-yl)butan-1-amine.
| Compound Name | 4-(2-morpholin-4-yl-5-nitro-1,3-thiazol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 19827638 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(2-morpholin-4-yl-5-nitro-1,3-thiazol-4-yl)butan-1-amine |
| SMILES | NCCCCc1nc(N2CCOCC2)sc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N4O3S/c12-4-2-1-3-9-10(15(16)17)19-11(13-9)14-5-7-18-8-6-14/h1-8,12H2 |
| InChIKey | CIRMTGDYDOLROG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|