C7H10N4O3S — CID 19827662
4-morpholin-4-yl-5-nitro-1,2-thiazol-3-amine (PubChem CID 19827662) has the molecular formula C7H10N4O3S and a molecular weight of 230.25 g/mol. Its IUPAC name is 4-morpholin-4-yl-5-nitro-1,2-thiazol-3-amine.
| Compound Name | 4-morpholin-4-yl-5-nitro-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 19827662 |
| Molecular Formula | C7H10N4O3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-morpholin-4-yl-5-nitro-1,2-thiazol-3-amine |
| SMILES | Nc1nsc([N+](=O)[O-])c1N1CCOCC1 |
| InChI | InChI=1S/C7H10N4O3S/c8-6-5(7(11(12)13)15-9-6)10-1-3-14-4-2-10/h1-4H2,(H2,8,9) |
| InChIKey | RLKNGHOVXVTGET-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|