C8H13N3OS2 — CID 103362097
4-methylsulfanyl-5-morpholin-4-yl-1,2-thiazol-3-amine (PubChem CID 103362097) has the molecular formula C8H13N3OS2 and a molecular weight of 231.35 g/mol. Its IUPAC name is 4-methylsulfanyl-5-morpholin-4-yl-1,2-thiazol-3-amine.
| Compound Name | 4-methylsulfanyl-5-morpholin-4-yl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103362097 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-methylsulfanyl-5-morpholin-4-yl-1,2-thiazol-3-amine |
| SMILES | CSc1c(N)nsc1N1CCOCC1 |
| InChI | InChI=1S/C8H13N3OS2/c1-13-6-7(9)10-14-8(6)11-2-4-12-5-3-11/h2-5H2,1H3,(H2,9,10) |
| InChIKey | BLMDLPAWKBTAOQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |