C11H17N3OS2 — CID 103360803
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methylsulfanyl-1,2-thiazol-3-amine (PubChem CID 103360803) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methylsulfanyl-1,2-thiazol-3-amine.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methylsulfanyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103360803 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4-methylsulfanyl-1,2-thiazol-3-amine |
| SMILES | CSc1c(N)nsc1N1CCOC2CCCC21 |
| InChI | InChI=1S/C11H17N3OS2/c1-16-9-10(12)13-17-11(9)14-5-6-15-8-4-2-3-7(8)14/h7-8H,2-6H2,1H3,(H2,12,13) |
| InChIKey | ISDXOIYQWWAHOE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |