C10H16N4O — CID 114998479
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1H-pyrazol-5-amine (PubChem CID 114998479) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 114998479 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1N1CCOC2CCCC21 |
| InChI | InChI=1S/C10H16N4O/c11-10-8(6-12-13-10)14-4-5-15-9-3-1-2-7(9)14/h6-7,9H,1-5H2,(H3,11,12,13) |
| InChIKey | GJPDENITENONSY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |