C14H20N4O — CID 80961930
6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-cyclopropylpyrimidin-4-amine (PubChem CID 80961930) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-cyclopropylpyrimidin-4-amine.
| Compound Name | 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80961930 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-cyclopropylpyrimidin-4-amine |
| SMILES | Nc1cc(N2CCOC3CCCC32)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H20N4O/c15-12-8-13(17-14(16-12)9-4-5-9)18-6-7-19-11-3-1-2-10(11)18/h8-11H,1-7H2,(H2,15,16,17) |
| InChIKey | ZWEKFKOPYUACLH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |