C13H21N5O2 — CID 113401820
[6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(methoxymethyl)pyrimidin-4-yl]hydrazine (PubChem CID 113401820) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is [6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(methoxymethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(methoxymethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 113401820 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | [6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-(methoxymethyl)pyrimidin-4-yl]hydrazine |
| SMILES | COCc1nc(NN)cc(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C13H21N5O2/c1-19-8-12-15-11(17-14)7-13(16-12)18-5-6-20-10-4-2-3-9(10)18/h7,9-10H,2-6,8,14H2,1H3,(H,15,16,17) |
| InChIKey | MQAOZTMXGCKRJU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|