C11H17N5O — CID 80901213
[6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)pyrazin-2-yl]hydrazine (PubChem CID 80901213) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is [6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)pyrazin-2-yl]hydrazine.
| Compound Name | [6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80901213 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | [6-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)pyrazin-2-yl]hydrazine |
| SMILES | NNc1cncc(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C11H17N5O/c12-15-10-6-13-7-11(14-10)16-4-5-17-9-3-1-2-8(9)16/h6-9H,1-5,12H2,(H,14,15) |
| InChIKey | ZEOFAMLTHDKCMX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|